C46H46N6O6 — CID 101134734
benzyl N-[(2S)-1-[[(1S)-1-[(2S,4R)-4-(3-azidopropyl)-5-oxooxolan-2-yl]-2-phenylethyl]amino]-1,4-dioxo-4-(tritylamino)butan-2-yl]carbamate (PubChem CID 101134734) has the molecular formula C46H46N6O6 and a molecular weight of 778.91 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(1S)-1-[(2S,4R)-4-(3-azidopropyl)-5-oxooxolan-2-yl]-2-phenylethyl]amino]-1,4-dioxo-4-(tritylamino)butan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(1S)-1-[(2S,4R)-4-(3-azidopropyl)-5-oxooxolan-2-yl]-2-phenylethyl]amino]-1,4-dioxo-4-(tritylamino)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 101134734 |
| Molecular Formula | C46H46N6O6 |
| Molecular Weight | 778.91 g/mol |
| Exact Mass | 778.35 |
| IUPAC Name | benzyl N-[(2S)-1-[[(1S)-1-[(2S,4R)-4-(3-azidopropyl)-5-oxooxolan-2-yl]-2-phenylethyl]amino]-1,4-dioxo-4-(tritylamino)butan-2-yl]carbamate |
| SMILES | [N-]=[N+]=NCCC[C@@H]1C[C@@H]([C@H](Cc2ccccc2)NC(=O)[C@H](CC(=O)NC(c2ccccc2)(c2ccccc2)c2ccccc2)NC(=O)OCc2ccccc2)OC1=O |
| InChI | InChI=1S/C46H46N6O6/c47-52-48-28-16-21-35-30-41(58-44(35)55)39(29-33-17-6-1-7-18-33)49-43(54)40(50-45(56)57-32-34-19-8-2-9-20-34)31-42(53)51-46(36-22-10-3-11-23-36,37-24-12-4-13-25-37)38-26-14-5-15-27-38/h1-15,17-20,22-27,35,39-41H,16,21,28-32H2,(H,49,54)(H,50,56)(H,51,53)/t35-,39+,40+,41+/m1/s1 |
| InChIKey | RUPVMHQWIZMKRO-ROMCXMQBSA-N |
| XLogP | 7.53 |
| TPSA | 171.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.91 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|