C30H40O2Si — CID 101134965
(1S,2S,4aR,8aR)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4a-dimethyl-2,5,6,7,8,8a-hexahydro-1H-naphthalene-1-carbaldehyde (PubChem CID 101134965) has the molecular formula C30H40O2Si and a molecular weight of 460.73 g/mol. Its IUPAC name is (1S,2S,4aR,8aR)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4a-dimethyl-2,5,6,7,8,8a-hexahydro-1H-naphthalene-1-carbaldehyde.
| Compound Name | (1S,2S,4aR,8aR)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4a-dimethyl-2,5,6,7,8,8a-hexahydro-1H-naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 101134965 |
| Molecular Formula | C30H40O2Si |
| Molecular Weight | 460.73 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | (1S,2S,4aR,8aR)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4a-dimethyl-2,5,6,7,8,8a-hexahydro-1H-naphthalene-1-carbaldehyde |
| SMILES | C[C@@H]1C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)=C[C@]2(C)CCCC[C@@H]2[C@H]1C=O |
| InChI | InChI=1S/C30H40O2Si/c1-23-24(20-30(5)19-13-12-18-28(30)27(23)21-31)22-32-33(29(2,3)4,25-14-8-6-9-15-25)26-16-10-7-11-17-26/h6-11,14-17,20-21,23,27-28H,12-13,18-19,22H2,1-5H3/t23-,27+,28-,30+/m1/s1 |
| InChIKey | RWPNFMCMVVOINH-MWSQIHEBSA-N |
| XLogP | 6.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.73 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|