C21H20ClN3OS2 — CID 10113497
(2Z,5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(1-methylpyridin-1-ium-2-yl)methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one chloride (PubChem CID 10113497) has the molecular formula C21H20ClN3OS2 and a molecular weight of 430.00 g/mol. Its IUPAC name is (2Z,5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(1-methylpyridin-1-ium-2-yl)methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one chloride.
| Compound Name | (2Z,5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(1-methylpyridin-1-ium-2-yl)methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one chloride |
|---|---|
| PubChem CID | 10113497 |
| Molecular Formula | C21H20ClN3OS2 |
| Molecular Weight | 430.00 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | (2Z,5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(1-methylpyridin-1-ium-2-yl)methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one chloride |
| SMILES | C=CCn1c(=O)/c(=C2\Sc3ccccc3N2C)s/c1=C\c1cccc[n+]1C.[Cl-] |
| InChI | InChI=1S/C21H20N3OS2.ClH/c1-4-12-24-18(14-15-9-7-8-13-22(15)2)27-19(20(24)25)21-23(3)16-10-5-6-11-17(16)26-21;/h4-11,13-14H,1,12H2,2-3H3;1H/q+1;/p-1/b21-19+; |
| InChIKey | GOJVIMGFIAWXFN-UXJRWBAGSA-M |
| XLogP | -0.94 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.00 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|