C19H34O3 — CID 101135219
(E,7S)-7-[(1S)-1-(2-methoxypropan-2-yloxy)ethyl]tridec-5-en-8-yn-7-ol (PubChem CID 101135219) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is (E,7S)-7-[(1S)-1-(2-methoxypropan-2-yloxy)ethyl]tridec-5-en-8-yn-7-ol.
| Compound Name | (E,7S)-7-[(1S)-1-(2-methoxypropan-2-yloxy)ethyl]tridec-5-en-8-yn-7-ol |
|---|---|
| PubChem CID | 101135219 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | (E,7S)-7-[(1S)-1-(2-methoxypropan-2-yloxy)ethyl]tridec-5-en-8-yn-7-ol |
| SMILES | CCCCC#C[C@@](O)(/C=C/CCCC)[C@H](C)OC(C)(C)OC |
| InChI | InChI=1S/C19H34O3/c1-7-9-11-13-15-19(20,16-14-12-10-8-2)17(3)22-18(4,5)21-6/h13,15,17,20H,7-12H2,1-6H3/b15-13+/t17-,19-/m0/s1 |
| InChIKey | MHLJMBVAKIUGGJ-QVWRBJFXSA-N |
| XLogP | 4.45 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|