About O-(2-phenylethyl) [1-(benzenesulfonyl)-3,3,3-trifluoropropyl]sulfanylmethanethioate
O-(2-phenylethyl) [1-(benzenesulfonyl)-3,3,3-trifluoropropyl]sulfanylmethanethioate (PubChem CID 101135320) has the molecular formula C18H17F3O3S3
and a molecular weight of 434.53 g/mol. Its IUPAC name is O-(2-phenylethyl) [1-(benzenesulfonyl)-3,3,3-trifluoropropyl]sulfanylmethanethioate.
Molecular Properties
| Compound Name | O-(2-phenylethyl) [1-(benzenesulfonyl)-3,3,3-trifluoropropyl]sulfanylmethanethioate |
| PubChem CID | 101135320 |
| Molecular Formula | C18H17F3O3S3 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | O-(2-phenylethyl) [1-(benzenesulfonyl)-3,3,3-trifluoropropyl]sulfanylmethanethioate |
| SMILES | O=S(=O)(c1ccccc1)C(CC(F)(F)F)SC(=S)OCCc1ccccc1 |
| InChI | InChI=1S/C18H17F3O3S3/c19-18(20,21)13-16(27(22,23)15-9-5-2-6-10-15)26-17(25)24-12-11-14-7-3-1-4-8-14/h1-10,16H,11-13H2 |
| InChIKey | SNRFYBNONWZYQG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(2-phenylethyl) [1-(benzenesulfonyl)-3,3,3-trifluoropropyl]sulfanylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(2-phenylethyl) [1-(benzenesulfonyl)-3,3,3-trifluoropropyl]sulfanylmethanethioate?
The IUPAC name of O-(2-phenylethyl) [1-(benzenesulfonyl)-3,3,3-trifluoropropyl]sulfanylmethanethioate (CID 101135320) is O-(2-phenylethyl) [1-(benzenesulfonyl)-3,3,3-trifluoropropyl]sulfanylmethanethioate.
What is the SMILES notation for O-(2-phenylethyl) [1-(benzenesulfonyl)-3,3,3-trifluoropropyl]sulfanylmethanethioate?
The canonical SMILES for O-(2-phenylethyl) [1-(benzenesulfonyl)-3,3,3-trifluoropropyl]sulfanylmethanethioate is O=S(=O)(c1ccccc1)C(CC(F)(F)F)SC(=S)OCCc1ccccc1.
What is the InChIKey of O-(2-phenylethyl) [1-(benzenesulfonyl)-3,3,3-trifluoropropyl]sulfanylmethanethioate?
The InChIKey is SNRFYBNONWZYQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F3O3S3/c19-18(20,21)13-16(27(22,23)15-9-5-2-6-10-15)26-17(25)24-12-11-14-7-3-1-4-8-14/h1-10,16H,11-13H2.
What are the key properties of O-(2-phenylethyl) [1-(benzenesulfonyl)-3,3,3-trifluoropropyl]sulfanylmethanethioate?
O-(2-phenylethyl) [1-(benzenesulfonyl)-3,3,3-trifluoropropyl]sulfanylmethanethioate has a molecular weight of 434.53 g/mol, XLogP of 5.02, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for O-(2-phenylethyl) [1-(benzenesulfonyl)-3,3,3-trifluoropropyl]sulfanylmethanethioate is sourced from PubChem (CID 101135320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).