About (E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-enal
(E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-enal (PubChem CID 101135390) has the molecular formula C13H26O2Si
and a molecular weight of 242.43 g/mol. Its IUPAC name is (E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-enal.
Molecular Properties
| Compound Name | (E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-enal |
| PubChem CID | 101135390 |
| Molecular Formula | C13H26O2Si |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-enal |
| SMILES | C/C(C=O)=C\[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H26O2Si/c1-11(9-14)8-12(2)10-15-16(6,7)13(3,4)5/h8-9,12H,10H2,1-7H3/b11-8+/t12-/m1/s1 |
| InChIKey | HFYIRWGBPAWDML-JATZPVMKSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-enal?
The IUPAC name of (E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-enal (CID 101135390) is (E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-enal.
What is the SMILES notation for (E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-enal?
The canonical SMILES for (E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-enal is C/C(C=O)=C\[C@@H](C)CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of (E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-enal?
The InChIKey is HFYIRWGBPAWDML-JATZPVMKSA-N. The full InChI is InChI=1S/C13H26O2Si/c1-11(9-14)8-12(2)10-15-16(6,7)13(3,4)5/h8-9,12H,10H2,1-7H3/b11-8+/t12-/m1/s1.
What are the key properties of (E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-enal?
(E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-enal has a molecular weight of 242.43 g/mol, XLogP of 3.79, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-enal is sourced from PubChem (CID 101135390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).