C29H42O3 — CID 101136315
(2Z,7E,11Z)-2-[3-(furan-3-yl)propylidene]-8,16-dimethyl-5-prop-1-en-2-ylheptadeca-7,11,15-trienoic acid (PubChem CID 101136315) has the molecular formula C29H42O3 and a molecular weight of 438.65 g/mol. Its IUPAC name is (2Z,7E,11Z)-2-[3-(furan-3-yl)propylidene]-8,16-dimethyl-5-prop-1-en-2-ylheptadeca-7,11,15-trienoic acid.
| Compound Name | (2Z,7E,11Z)-2-[3-(furan-3-yl)propylidene]-8,16-dimethyl-5-prop-1-en-2-ylheptadeca-7,11,15-trienoic acid |
|---|---|
| PubChem CID | 101136315 |
| Molecular Formula | C29H42O3 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | (2Z,7E,11Z)-2-[3-(furan-3-yl)propylidene]-8,16-dimethyl-5-prop-1-en-2-ylheptadeca-7,11,15-trienoic acid |
| SMILES | C=C(C)C(C/C=C(\C)CC/C=C\CCC=C(C)C)CC/C(=C/CCc1ccoc1)C(=O)O |
| InChI | InChI=1S/C29H42O3/c1-23(2)12-9-7-6-8-10-13-25(5)16-17-27(24(3)4)18-19-28(29(30)31)15-11-14-26-20-21-32-22-26/h6,8,12,15-16,20-22,27H,3,7,9-11,13-14,17-19H2,1-2,4-5H3,(H,30,31)/b8-6-,25-16+,28-15- |
| InChIKey | DPCFRWLURJRRGS-BZZDFEAQSA-N |
| XLogP | 8.61 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|