C23H21FN6O2 — CID 10113636
2-[[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]methoxy]ethanol (PubChem CID 10113636) has the molecular formula C23H21FN6O2 and a molecular weight of 432.46 g/mol. Its IUPAC name is 2-[[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]methoxy]ethanol.
| Compound Name | 2-[[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]methoxy]ethanol |
|---|---|
| PubChem CID | 10113636 |
| Molecular Formula | C23H21FN6O2 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 2-[[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]methoxy]ethanol |
| SMILES | OCCOCc1ccn2ncnc(Nc3ccc4c(cnn4Cc4cccc(F)c4)c3)c12 |
| InChI | InChI=1S/C23H21FN6O2/c24-19-3-1-2-16(10-19)13-30-21-5-4-20(11-18(21)12-26-30)28-23-22-17(14-32-9-8-31)6-7-29(22)27-15-25-23/h1-7,10-12,15,31H,8-9,13-14H2,(H,25,27,28) |
| InChIKey | UZIHKKYRIJAQNZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 89.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|