C16H24N2O5 — CID 101136608
2-[(4-hydroxy-3-methoxybenzoyl)amino]ethyl (2S,3S)-2-amino-3-methylpentanoate (PubChem CID 101136608) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-[(4-hydroxy-3-methoxybenzoyl)amino]ethyl (2S,3S)-2-amino-3-methylpentanoate.
| Compound Name | 2-[(4-hydroxy-3-methoxybenzoyl)amino]ethyl (2S,3S)-2-amino-3-methylpentanoate |
|---|---|
| PubChem CID | 101136608 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 2-[(4-hydroxy-3-methoxybenzoyl)amino]ethyl (2S,3S)-2-amino-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H](N)C(=O)OCCNC(=O)c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C16H24N2O5/c1-4-10(2)14(17)16(21)23-8-7-18-15(20)11-5-6-12(19)13(9-11)22-3/h5-6,9-10,14,19H,4,7-8,17H2,1-3H3,(H,18,20)/t10-,14-/m0/s1 |
| InChIKey | GBELGVLGCZZFIG-HZMBPMFUSA-N |
| XLogP | 1.05 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|