C17H27NO4 — CID 101137474
dipropan-2-yl (9aS)-1,2,6,7,8,9-hexahydroquinolizine-3,9a-dicarboxylate (PubChem CID 101137474) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is dipropan-2-yl (9aS)-1,2,6,7,8,9-hexahydroquinolizine-3,9a-dicarboxylate.
| Compound Name | dipropan-2-yl (9aS)-1,2,6,7,8,9-hexahydroquinolizine-3,9a-dicarboxylate |
|---|---|
| PubChem CID | 101137474 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | dipropan-2-yl (9aS)-1,2,6,7,8,9-hexahydroquinolizine-3,9a-dicarboxylate |
| SMILES | CC(C)OC(=O)C1=CN2CCCC[C@@]2(C(=O)OC(C)C)CC1 |
| InChI | InChI=1S/C17H27NO4/c1-12(2)21-15(19)14-7-9-17(16(20)22-13(3)4)8-5-6-10-18(17)11-14/h11-13H,5-10H2,1-4H3/t17-/m0/s1 |
| InChIKey | URNLQFOUKFVFCV-KRWDZBQOSA-N |
| XLogP | 2.79 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |