C12H18 — CID 101137554
(4aS,4bR)-1,2,3,4,4a,4b,5,6,7,8-decahydrobiphenylene (PubChem CID 101137554) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is (4aS,4bR)-1,2,3,4,4a,4b,5,6,7,8-decahydrobiphenylene.
| Compound Name | (4aS,4bR)-1,2,3,4,4a,4b,5,6,7,8-decahydrobiphenylene |
|---|---|
| PubChem CID | 101137554 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | (4aS,4bR)-1,2,3,4,4a,4b,5,6,7,8-decahydrobiphenylene |
| SMILES | C1CC[C@@H]2C(=C3CCCC[C@@H]32)C1 |
| InChI | InChI=1S/C12H18/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11/h9,11H,1-8H2/t9-,11- |
| InChIKey | JGLSDANNGXIVOL-HOMQSWHASA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|