C28H28N2O4 — CID 1011377
3-(4-methoxyphenyl)-N-[[3-[[3-(4-methoxyphenyl)prop-2-enoylamino]methyl]phenyl]methyl]prop-2-enamide (PubChem CID 1011377) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N-[[3-[[3-(4-methoxyphenyl)prop-2-enoylamino]methyl]phenyl]methyl]prop-2-enamide.
| Compound Name | 3-(4-methoxyphenyl)-N-[[3-[[3-(4-methoxyphenyl)prop-2-enoylamino]methyl]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 1011377 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 3-(4-methoxyphenyl)-N-[[3-[[3-(4-methoxyphenyl)prop-2-enoylamino]methyl]phenyl]methyl]prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)NCc2cccc(CNC(=O)C=Cc3ccc(OC)cc3)c2)cc1 |
| InChI | InChI=1S/C28H28N2O4/c1-33-25-12-6-21(7-13-25)10-16-27(31)29-19-23-4-3-5-24(18-23)20-30-28(32)17-11-22-8-14-26(34-2)15-9-22/h3-18H,19-20H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | MKHNOZLTGLMQLE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|