C13H20O — CID 101138228
(1S,2R,4R)-1,3,3-trimethyl-2-prop-2-ynoxybicyclo[2.2.1]heptane (PubChem CID 101138228) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is (1S,2R,4R)-1,3,3-trimethyl-2-prop-2-ynoxybicyclo[2.2.1]heptane.
| Compound Name | (1S,2R,4R)-1,3,3-trimethyl-2-prop-2-ynoxybicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 101138228 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (1S,2R,4R)-1,3,3-trimethyl-2-prop-2-ynoxybicyclo[2.2.1]heptane |
| SMILES | C#CCO[C@H]1C(C)(C)[C@@H]2CC[C@@]1(C)C2 |
| InChI | InChI=1S/C13H20O/c1-5-8-14-11-12(2,3)10-6-7-13(11,4)9-10/h1,10-11H,6-9H2,2-4H3/t10-,11+,13+/m1/s1 |
| InChIKey | DOPMBPNVWIMSBH-MDZLAQPJSA-N |
| XLogP | 2.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|