C17H12O3 — CID 101138705
12-oxatetracyclo[11.4.1.02,11.04,9]octadeca-2(11),4,6,8,14,16-hexaene-3,10-dione (PubChem CID 101138705) has the molecular formula C17H12O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 12-oxatetracyclo[11.4.1.02,11.04,9]octadeca-2(11),4,6,8,14,16-hexaene-3,10-dione.
| Compound Name | 12-oxatetracyclo[11.4.1.02,11.04,9]octadeca-2(11),4,6,8,14,16-hexaene-3,10-dione |
|---|---|
| PubChem CID | 101138705 |
| Molecular Formula | C17H12O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 12-oxatetracyclo[11.4.1.02,11.04,9]octadeca-2(11),4,6,8,14,16-hexaene-3,10-dione |
| SMILES | O=C1C2=C(C(=O)c3ccccc31)C1C=CC=CC(C1)O2 |
| InChI | InChI=1S/C17H12O3/c18-15-12-7-3-4-8-13(12)16(19)17-14(15)10-5-1-2-6-11(9-10)20-17/h1-8,10-11H,9H2 |
| InChIKey | HVNSFWNFRWTKNV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|