C20H30O5 — CID 101138865
(1R,2S,3R,8R,10E,14R,15S)-2,3-dihydroxy-1,5,10,14-tetramethyl-7,18-dioxatricyclo[13.2.1.04,8]octadeca-4,10-dien-6-one (PubChem CID 101138865) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (1R,2S,3R,8R,10E,14R,15S)-2,3-dihydroxy-1,5,10,14-tetramethyl-7,18-dioxatricyclo[13.2.1.04,8]octadeca-4,10-dien-6-one.
| Compound Name | (1R,2S,3R,8R,10E,14R,15S)-2,3-dihydroxy-1,5,10,14-tetramethyl-7,18-dioxatricyclo[13.2.1.04,8]octadeca-4,10-dien-6-one |
|---|---|
| PubChem CID | 101138865 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (1R,2S,3R,8R,10E,14R,15S)-2,3-dihydroxy-1,5,10,14-tetramethyl-7,18-dioxatricyclo[13.2.1.04,8]octadeca-4,10-dien-6-one |
| SMILES | CC1=C2[C@@H](O)[C@H](O)[C@@]3(C)CC[C@H](O3)[C@H](C)CC/C=C(\C)C[C@H]2OC1=O |
| InChI | InChI=1S/C20H30O5/c1-11-6-5-7-12(2)14-8-9-20(4,25-14)18(22)17(21)16-13(3)19(23)24-15(16)10-11/h6,12,14-15,17-18,21-22H,5,7-10H2,1-4H3/b11-6+/t12-,14+,15-,17-,18+,20-/m1/s1 |
| InChIKey | UBMHMIZHPPOKIP-WEODBMSGSA-N |
| XLogP | 2.65 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|