C22H21F2N7O — CID 10113957
(E,2R,3S)-2-(2,4-difluorophenyl)-3-methyl-6-[4-(tetrazol-1-yl)phenyl]-1-(1,2,4-triazol-1-yl)hex-5-en-2-ol (PubChem CID 10113957) has the molecular formula C22H21F2N7O and a molecular weight of 437.45 g/mol. Its IUPAC name is (E,2R,3S)-2-(2,4-difluorophenyl)-3-methyl-6-[4-(tetrazol-1-yl)phenyl]-1-(1,2,4-triazol-1-yl)hex-5-en-2-ol.
| Compound Name | (E,2R,3S)-2-(2,4-difluorophenyl)-3-methyl-6-[4-(tetrazol-1-yl)phenyl]-1-(1,2,4-triazol-1-yl)hex-5-en-2-ol |
|---|---|
| PubChem CID | 10113957 |
| Molecular Formula | C22H21F2N7O |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | (E,2R,3S)-2-(2,4-difluorophenyl)-3-methyl-6-[4-(tetrazol-1-yl)phenyl]-1-(1,2,4-triazol-1-yl)hex-5-en-2-ol |
| SMILES | C[C@@H](C/C=C/c1ccc(-n2cnnn2)cc1)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C22H21F2N7O/c1-16(3-2-4-17-5-8-19(9-6-17)31-15-26-28-29-31)22(32,12-30-14-25-13-27-30)20-10-7-18(23)11-21(20)24/h2,4-11,13-16,32H,3,12H2,1H3/b4-2+/t16-,22+/m0/s1 |
| InChIKey | CYTGYEOVOVFMCG-KYMMHVTGSA-N |
| XLogP | 3.16 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |