C25H22F3N3O — CID 10113958
10-(4-methoxy-2-methylphenyl)-11-methyl-2-[3-(trifluoromethyl)phenyl]-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene (PubChem CID 10113958) has the molecular formula C25H22F3N3O and a molecular weight of 437.47 g/mol. Its IUPAC name is 10-(4-methoxy-2-methylphenyl)-11-methyl-2-[3-(trifluoromethyl)phenyl]-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene.
| Compound Name | 10-(4-methoxy-2-methylphenyl)-11-methyl-2-[3-(trifluoromethyl)phenyl]-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
|---|---|
| PubChem CID | 10113958 |
| Molecular Formula | C25H22F3N3O |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 10-(4-methoxy-2-methylphenyl)-11-methyl-2-[3-(trifluoromethyl)phenyl]-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
| SMILES | COc1ccc(-c2c(C)nn3c(-c4cccc(C(F)(F)F)c4)c4c(nc23)CCC4)c(C)c1 |
| InChI | InChI=1S/C25H22F3N3O/c1-14-12-18(32-3)10-11-19(14)22-15(2)30-31-23(20-8-5-9-21(20)29-24(22)31)16-6-4-7-17(13-16)25(26,27)28/h4,6-7,10-13H,5,8-9H2,1-3H3 |
| InChIKey | IXBYIHGFMDUJBM-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |