C16H17NO2 — CID 101139837
(3R,4S)-6-methoxy-4-phenyl-1,2,3,4-tetrahydroquinolin-3-ol (PubChem CID 101139837) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is (3R,4S)-6-methoxy-4-phenyl-1,2,3,4-tetrahydroquinolin-3-ol.
| Compound Name | (3R,4S)-6-methoxy-4-phenyl-1,2,3,4-tetrahydroquinolin-3-ol |
|---|---|
| PubChem CID | 101139837 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (3R,4S)-6-methoxy-4-phenyl-1,2,3,4-tetrahydroquinolin-3-ol |
| SMILES | COc1ccc2c(c1)[C@H](c1ccccc1)[C@@H](O)CN2 |
| InChI | InChI=1S/C16H17NO2/c1-19-12-7-8-14-13(9-12)16(15(18)10-17-14)11-5-3-2-4-6-11/h2-9,15-18H,10H2,1H3/t15-,16-/m0/s1 |
| InChIKey | GRLLVVZSCSETRN-HOTGVXAUSA-N |
| XLogP | 2.61 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|