About (5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-one
(5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-one (PubChem CID 101140100) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is (5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-one.
Molecular Properties
| Compound Name | (5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-one |
| PubChem CID | 101140100 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-one |
| SMILES | O=C1C=CC[C@@]12CCCC21OCCO1 |
| InChI | InChI=1S/C11H14O3/c12-9-3-1-4-10(9)5-2-6-11(10)13-7-8-14-11/h1,3H,2,4-8H2/t10-/m1/s1 |
| InChIKey | WNRPNRJYFZNRMQ-SNVBAGLBSA-N |
| XLogP | 1.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-one?
The IUPAC name of (5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-one (CID 101140100) is (5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-one.
What is the SMILES notation for (5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-one?
The canonical SMILES for (5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-one is O=C1C=CC[C@@]12CCCC21OCCO1.
What is the InChIKey of (5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-one?
The InChIKey is WNRPNRJYFZNRMQ-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H14O3/c12-9-3-1-4-10(9)5-2-6-11(10)13-7-8-14-11/h1,3H,2,4-8H2/t10-/m1/s1.
What are the key properties of (5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-one?
(5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-one has a molecular weight of 194.23 g/mol, XLogP of 1.43, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-one is sourced from PubChem (CID 101140100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).