C22H22N4O6 — CID 10114013
tert-butyl 4-(4-nitronaphthalen-1-yl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylate (PubChem CID 10114013) has the molecular formula C22H22N4O6 and a molecular weight of 438.44 g/mol. Its IUPAC name is tert-butyl 4-(4-nitronaphthalen-1-yl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylate.
| Compound Name | tert-butyl 4-(4-nitronaphthalen-1-yl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylate |
|---|---|
| PubChem CID | 10114013 |
| Molecular Formula | C22H22N4O6 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | tert-butyl 4-(4-nitronaphthalen-1-yl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CC1C1C(=O)N(c3ccc([N+](=O)[O-])c4ccccc34)C(=O)N21 |
| InChI | InChI=1S/C22H22N4O6/c1-22(2,3)32-21(29)23-11-12-10-17(23)18-19(27)25(20(28)24(12)18)15-8-9-16(26(30)31)14-7-5-4-6-13(14)15/h4-9,12,17-18H,10-11H2,1-3H3 |
| InChIKey | YBKVFRWWSSDFHO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 113.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|