About (1,8-dichloro-9,10-dihydroanthracen-9-yl) 2-bromoacetate
(1,8-dichloro-9,10-dihydroanthracen-9-yl) 2-bromoacetate (PubChem CID 101140247) has the molecular formula C16H11BrCl2O2
and a molecular weight of 386.07 g/mol. Its IUPAC name is (1,8-dichloro-9,10-dihydroanthracen-9-yl) 2-bromoacetate.
Molecular Properties
| Compound Name | (1,8-dichloro-9,10-dihydroanthracen-9-yl) 2-bromoacetate |
| PubChem CID | 101140247 |
| Molecular Formula | C16H11BrCl2O2 |
| Molecular Weight | 386.07 g/mol |
| Exact Mass | 383.93 |
| IUPAC Name | (1,8-dichloro-9,10-dihydroanthracen-9-yl) 2-bromoacetate |
| SMILES | O=C(CBr)OC1c2c(Cl)cccc2Cc2cccc(Cl)c21 |
| InChI | InChI=1S/C16H11BrCl2O2/c17-8-13(20)21-16-14-9(3-1-5-11(14)18)7-10-4-2-6-12(19)15(10)16/h1-6,16H,7-8H2 |
| InChIKey | PCFACVNWFLEHMU-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.07 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (1,8-dichloro-9,10-dihydroanthracen-9-yl) 2-bromoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,8-dichloro-9,10-dihydroanthracen-9-yl) 2-bromoacetate?
The IUPAC name of (1,8-dichloro-9,10-dihydroanthracen-9-yl) 2-bromoacetate (CID 101140247) is (1,8-dichloro-9,10-dihydroanthracen-9-yl) 2-bromoacetate.
What is the SMILES notation for (1,8-dichloro-9,10-dihydroanthracen-9-yl) 2-bromoacetate?
The canonical SMILES for (1,8-dichloro-9,10-dihydroanthracen-9-yl) 2-bromoacetate is O=C(CBr)OC1c2c(Cl)cccc2Cc2cccc(Cl)c21.
What is the InChIKey of (1,8-dichloro-9,10-dihydroanthracen-9-yl) 2-bromoacetate?
The InChIKey is PCFACVNWFLEHMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11BrCl2O2/c17-8-13(20)21-16-14-9(3-1-5-11(14)18)7-10-4-2-6-12(19)15(10)16/h1-6,16H,7-8H2.
What are the key properties of (1,8-dichloro-9,10-dihydroanthracen-9-yl) 2-bromoacetate?
(1,8-dichloro-9,10-dihydroanthracen-9-yl) 2-bromoacetate has a molecular weight of 386.07 g/mol, XLogP of 4.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1,8-dichloro-9,10-dihydroanthracen-9-yl) 2-bromoacetate is sourced from PubChem (CID 101140247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).