About 1-methyl-4-[(1E,3Z)-4-methylsulfanyl-2-nitrobuta-1,3-dienyl]benzene
1-methyl-4-[(1E,3Z)-4-methylsulfanyl-2-nitrobuta-1,3-dienyl]benzene (PubChem CID 101140274) has the molecular formula C12H13NO2S
and a molecular weight of 235.31 g/mol. Its IUPAC name is 1-methyl-4-[(1E,3Z)-4-methylsulfanyl-2-nitrobuta-1,3-dienyl]benzene.
Molecular Properties
| Compound Name | 1-methyl-4-[(1E,3Z)-4-methylsulfanyl-2-nitrobuta-1,3-dienyl]benzene |
| PubChem CID | 101140274 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 1-methyl-4-[(1E,3Z)-4-methylsulfanyl-2-nitrobuta-1,3-dienyl]benzene |
| SMILES | CS/C=C\C(=C/c1ccc(C)cc1)[N+](=O)[O-] |
| InChI | InChI=1S/C12H13NO2S/c1-10-3-5-11(6-4-10)9-12(13(14)15)7-8-16-2/h3-9H,1-2H3/b8-7-,12-9+ |
| InChIKey | OTWBBXATPSOGCT-HVTAIUIQSA-N |
| XLogP | 3.49 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-[(1E,3Z)-4-methylsulfanyl-2-nitrobuta-1,3-dienyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[(1E,3Z)-4-methylsulfanyl-2-nitrobuta-1,3-dienyl]benzene?
The IUPAC name of 1-methyl-4-[(1E,3Z)-4-methylsulfanyl-2-nitrobuta-1,3-dienyl]benzene (CID 101140274) is 1-methyl-4-[(1E,3Z)-4-methylsulfanyl-2-nitrobuta-1,3-dienyl]benzene.
What is the SMILES notation for 1-methyl-4-[(1E,3Z)-4-methylsulfanyl-2-nitrobuta-1,3-dienyl]benzene?
The canonical SMILES for 1-methyl-4-[(1E,3Z)-4-methylsulfanyl-2-nitrobuta-1,3-dienyl]benzene is CS/C=C\C(=C/c1ccc(C)cc1)[N+](=O)[O-].
What is the InChIKey of 1-methyl-4-[(1E,3Z)-4-methylsulfanyl-2-nitrobuta-1,3-dienyl]benzene?
The InChIKey is OTWBBXATPSOGCT-HVTAIUIQSA-N. The full InChI is InChI=1S/C12H13NO2S/c1-10-3-5-11(6-4-10)9-12(13(14)15)7-8-16-2/h3-9H,1-2H3/b8-7-,12-9+.
What are the key properties of 1-methyl-4-[(1E,3Z)-4-methylsulfanyl-2-nitrobuta-1,3-dienyl]benzene?
1-methyl-4-[(1E,3Z)-4-methylsulfanyl-2-nitrobuta-1,3-dienyl]benzene has a molecular weight of 235.31 g/mol, XLogP of 3.49, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[(1E,3Z)-4-methylsulfanyl-2-nitrobuta-1,3-dienyl]benzene is sourced from PubChem (CID 101140274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).