About 1-[(2S,3R)-2-phenyloxetan-3-yl]butan-1-ol
1-[(2S,3R)-2-phenyloxetan-3-yl]butan-1-ol (PubChem CID 101140305) has the molecular formula C13H18O2
and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-[(2S,3R)-2-phenyloxetan-3-yl]butan-1-ol.
Molecular Properties
| Compound Name | 1-[(2S,3R)-2-phenyloxetan-3-yl]butan-1-ol |
| PubChem CID | 101140305 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 1-[(2S,3R)-2-phenyloxetan-3-yl]butan-1-ol |
| SMILES | CCCC(O)[C@H]1CO[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C13H18O2/c1-2-6-12(14)11-9-15-13(11)10-7-4-3-5-8-10/h3-5,7-8,11-14H,2,6,9H2,1H3/t11-,12?,13-/m1/s1 |
| InChIKey | XWVQUMGHBCESMY-LKOMHFJYSA-N |
| XLogP | 2.54 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2S,3R)-2-phenyloxetan-3-yl]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S,3R)-2-phenyloxetan-3-yl]butan-1-ol?
The IUPAC name of 1-[(2S,3R)-2-phenyloxetan-3-yl]butan-1-ol (CID 101140305) is 1-[(2S,3R)-2-phenyloxetan-3-yl]butan-1-ol.
What is the SMILES notation for 1-[(2S,3R)-2-phenyloxetan-3-yl]butan-1-ol?
The canonical SMILES for 1-[(2S,3R)-2-phenyloxetan-3-yl]butan-1-ol is CCCC(O)[C@H]1CO[C@@H]1c1ccccc1.
What is the InChIKey of 1-[(2S,3R)-2-phenyloxetan-3-yl]butan-1-ol?
The InChIKey is XWVQUMGHBCESMY-LKOMHFJYSA-N. The full InChI is InChI=1S/C13H18O2/c1-2-6-12(14)11-9-15-13(11)10-7-4-3-5-8-10/h3-5,7-8,11-14H,2,6,9H2,1H3/t11-,12?,13-/m1/s1.
What are the key properties of 1-[(2S,3R)-2-phenyloxetan-3-yl]butan-1-ol?
1-[(2S,3R)-2-phenyloxetan-3-yl]butan-1-ol has a molecular weight of 206.29 g/mol, XLogP of 2.54, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S,3R)-2-phenyloxetan-3-yl]butan-1-ol is sourced from PubChem (CID 101140305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).