C44H41N3O8 — CID 101140671
dicyclohexyl 10b-(3,5-dinitrophenyl)spiro[5,6-dihydropyrrolo[2,1-a]isoquinoline-1,9'-fluorene]-2,3-dicarboxylate (PubChem CID 101140671) has the molecular formula C44H41N3O8 and a molecular weight of 739.82 g/mol. Its IUPAC name is dicyclohexyl 10b-(3,5-dinitrophenyl)spiro[5,6-dihydropyrrolo[2,1-a]isoquinoline-1,9'-fluorene]-2,3-dicarboxylate.
| Compound Name | dicyclohexyl 10b-(3,5-dinitrophenyl)spiro[5,6-dihydropyrrolo[2,1-a]isoquinoline-1,9'-fluorene]-2,3-dicarboxylate |
|---|---|
| PubChem CID | 101140671 |
| Molecular Formula | C44H41N3O8 |
| Molecular Weight | 739.82 g/mol |
| Exact Mass | 739.29 |
| IUPAC Name | dicyclohexyl 10b-(3,5-dinitrophenyl)spiro[5,6-dihydropyrrolo[2,1-a]isoquinoline-1,9'-fluorene]-2,3-dicarboxylate |
| SMILES | O=C(OC1CCCCC1)C1=C(C(=O)OC2CCCCC2)C2(c3ccccc3-c3ccccc32)C2(c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)c3ccccc3CCN12 |
| InChI | InChI=1S/C44H41N3O8/c48-41(54-32-14-3-1-4-15-32)39-40(42(49)55-33-16-5-2-6-17-33)45-24-23-28-13-7-10-20-36(28)44(45,29-25-30(46(50)51)27-31(26-29)47(52)53)43(39)37-21-11-8-18-34(37)35-19-9-12-22-38(35)43/h7-13,18-22,25-27,32-33H,1-6,14-17,23-24H2 |
| InChIKey | PQNHCGYOIOAZGO-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.82 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|