C36H29N3O8 — CID 101140680
diethyl 10b-(3,5-dinitrophenyl)spiro[5,6-dihydropyrrolo[2,1-a]isoquinoline-1,9'-fluorene]-2,3-dicarboxylate (PubChem CID 101140680) has the molecular formula C36H29N3O8 and a molecular weight of 631.64 g/mol. Its IUPAC name is diethyl 10b-(3,5-dinitrophenyl)spiro[5,6-dihydropyrrolo[2,1-a]isoquinoline-1,9'-fluorene]-2,3-dicarboxylate.
| Compound Name | diethyl 10b-(3,5-dinitrophenyl)spiro[5,6-dihydropyrrolo[2,1-a]isoquinoline-1,9'-fluorene]-2,3-dicarboxylate |
|---|---|
| PubChem CID | 101140680 |
| Molecular Formula | C36H29N3O8 |
| Molecular Weight | 631.64 g/mol |
| Exact Mass | 631.20 |
| IUPAC Name | diethyl 10b-(3,5-dinitrophenyl)spiro[5,6-dihydropyrrolo[2,1-a]isoquinoline-1,9'-fluorene]-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)C2(c3ccccc3-c3ccccc32)C2(c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)c3ccccc3CCN12 |
| InChI | InChI=1S/C36H29N3O8/c1-3-46-33(40)31-32(34(41)47-4-2)37-18-17-22-11-5-8-14-28(22)36(37,23-19-24(38(42)43)21-25(20-23)39(44)45)35(31)29-15-9-6-12-26(29)27-13-7-10-16-30(27)35/h5-16,19-21H,3-4,17-18H2,1-2H3 |
| InChIKey | GZERCQYSKMGAER-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.64 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|