C34H23Br2N3O8 — CID 101140681
dimethyl 2',7'-dibromo-10b-(3,5-dinitrophenyl)spiro[5,6-dihydropyrrolo[2,1-a]isoquinoline-1,9'-fluorene]-2,3-dicarboxylate (PubChem CID 101140681) has the molecular formula C34H23Br2N3O8 and a molecular weight of 761.38 g/mol. Its IUPAC name is dimethyl 2',7'-dibromo-10b-(3,5-dinitrophenyl)spiro[5,6-dihydropyrrolo[2,1-a]isoquinoline-1,9'-fluorene]-2,3-dicarboxylate.
| Compound Name | dimethyl 2',7'-dibromo-10b-(3,5-dinitrophenyl)spiro[5,6-dihydropyrrolo[2,1-a]isoquinoline-1,9'-fluorene]-2,3-dicarboxylate |
|---|---|
| PubChem CID | 101140681 |
| Molecular Formula | C34H23Br2N3O8 |
| Molecular Weight | 761.38 g/mol |
| Exact Mass | 758.99 |
| IUPAC Name | dimethyl 2',7'-dibromo-10b-(3,5-dinitrophenyl)spiro[5,6-dihydropyrrolo[2,1-a]isoquinoline-1,9'-fluorene]-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(c3cc(Br)ccc3-c3ccc(Br)cc32)C2(c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)c3ccccc3CCN12 |
| InChI | InChI=1S/C34H23Br2N3O8/c1-46-31(40)29-30(32(41)47-2)37-12-11-18-5-3-4-6-26(18)34(37,19-13-22(38(42)43)17-23(14-19)39(44)45)33(29)27-15-20(35)7-9-24(27)25-10-8-21(36)16-28(25)33/h3-10,13-17H,11-12H2,1-2H3 |
| InChIKey | OOPADKMNVJQAAW-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.38 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|