C40H37N3O8 — CID 101140684
ditert-butyl 10b-(3,5-dinitrophenyl)spiro[5,6-dihydropyrrolo[2,1-a]isoquinoline-1,9'-fluorene]-2,3-dicarboxylate (PubChem CID 101140684) has the molecular formula C40H37N3O8 and a molecular weight of 687.75 g/mol. Its IUPAC name is ditert-butyl 10b-(3,5-dinitrophenyl)spiro[5,6-dihydropyrrolo[2,1-a]isoquinoline-1,9'-fluorene]-2,3-dicarboxylate.
| Compound Name | ditert-butyl 10b-(3,5-dinitrophenyl)spiro[5,6-dihydropyrrolo[2,1-a]isoquinoline-1,9'-fluorene]-2,3-dicarboxylate |
|---|---|
| PubChem CID | 101140684 |
| Molecular Formula | C40H37N3O8 |
| Molecular Weight | 687.75 g/mol |
| Exact Mass | 687.26 |
| IUPAC Name | ditert-butyl 10b-(3,5-dinitrophenyl)spiro[5,6-dihydropyrrolo[2,1-a]isoquinoline-1,9'-fluorene]-2,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1=C(C(=O)OC(C)(C)C)C2(c3ccccc3-c3ccccc32)C2(c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)c3ccccc3CCN12 |
| InChI | InChI=1S/C40H37N3O8/c1-37(2,3)50-35(44)33-34(36(45)51-38(4,5)6)41-20-19-24-13-7-10-16-30(24)40(41,25-21-26(42(46)47)23-27(22-25)43(48)49)39(33)31-17-11-8-14-28(31)29-15-9-12-18-32(29)39/h7-18,21-23H,19-20H2,1-6H3 |
| InChIKey | WTGJGZCYOZSSLA-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.75 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|