About (1R)-1-cyano-2,2-diethoxycyclohexan-1-olate
(1R)-1-cyano-2,2-diethoxycyclohexan-1-olate (PubChem CID 101141224) has the molecular formula C11H18NO3-
and a molecular weight of 212.27 g/mol. Its IUPAC name is (1R)-1-cyano-2,2-diethoxycyclohexan-1-olate.
Molecular Properties
| Compound Name | (1R)-1-cyano-2,2-diethoxycyclohexan-1-olate |
| PubChem CID | 101141224 |
| Molecular Formula | C11H18NO3- |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (1R)-1-cyano-2,2-diethoxycyclohexan-1-olate |
| SMILES | CCOC1(OCC)CCCC[C@@]1([O-])C#N |
| InChI | InChI=1S/C11H18NO3/c1-3-14-11(15-4-2)8-6-5-7-10(11,13)9-12/h3-8H2,1-2H3/q-1/t10-/m1/s1 |
| InChIKey | AWCRFZXGNLGKSQ-SNVBAGLBSA-N |
| XLogP | 0.95 |
| TPSA | 65.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-cyano-2,2-diethoxycyclohexan-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-cyano-2,2-diethoxycyclohexan-1-olate?
The IUPAC name of (1R)-1-cyano-2,2-diethoxycyclohexan-1-olate (CID 101141224) is (1R)-1-cyano-2,2-diethoxycyclohexan-1-olate.
What is the SMILES notation for (1R)-1-cyano-2,2-diethoxycyclohexan-1-olate?
The canonical SMILES for (1R)-1-cyano-2,2-diethoxycyclohexan-1-olate is CCOC1(OCC)CCCC[C@@]1([O-])C#N.
What is the InChIKey of (1R)-1-cyano-2,2-diethoxycyclohexan-1-olate?
The InChIKey is AWCRFZXGNLGKSQ-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H18NO3/c1-3-14-11(15-4-2)8-6-5-7-10(11,13)9-12/h3-8H2,1-2H3/q-1/t10-/m1/s1.
What are the key properties of (1R)-1-cyano-2,2-diethoxycyclohexan-1-olate?
(1R)-1-cyano-2,2-diethoxycyclohexan-1-olate has a molecular weight of 212.27 g/mol, XLogP of 0.95, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-cyano-2,2-diethoxycyclohexan-1-olate is sourced from PubChem (CID 101141224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).