C21H18ClN5O4 — CID 10114130
3-[4-[(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)methyl]phenyl]-1,1-dimethylurea (PubChem CID 10114130) has the molecular formula C21H18ClN5O4 and a molecular weight of 439.86 g/mol. Its IUPAC name is 3-[4-[(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)methyl]phenyl]-1,1-dimethylurea.
| Compound Name | 3-[4-[(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)methyl]phenyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 10114130 |
| Molecular Formula | C21H18ClN5O4 |
| Molecular Weight | 439.86 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 3-[4-[(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)methyl]phenyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1ccc(Cn2[nH]c(=O)c3[nH]c4cc(Cl)ccc4c(=O)c3c2=O)cc1 |
| InChI | InChI=1S/C21H18ClN5O4/c1-26(2)21(31)23-13-6-3-11(4-7-13)10-27-20(30)16-17(19(29)25-27)24-15-9-12(22)5-8-14(15)18(16)28/h3-9H,10H2,1-2H3,(H,23,31)(H,24,28)(H,25,29) |
| InChIKey | TVQQUUVYPKGIMU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 120.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.86 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|