About (1E,4E)-5-hydroxy-3-oxopenta-1,4-dien-1-olate
(1E,4E)-5-hydroxy-3-oxopenta-1,4-dien-1-olate (PubChem CID 101141300) has the molecular formula C5H5O3-
and a molecular weight of 113.09 g/mol. Its IUPAC name is (1E,4E)-5-hydroxy-3-oxopenta-1,4-dien-1-olate.
Molecular Properties
| Compound Name | (1E,4E)-5-hydroxy-3-oxopenta-1,4-dien-1-olate |
| PubChem CID | 101141300 |
| Molecular Formula | C5H5O3- |
| Molecular Weight | 113.09 g/mol |
| Exact Mass | 113.02 |
| IUPAC Name | (1E,4E)-5-hydroxy-3-oxopenta-1,4-dien-1-olate |
| SMILES | O=C(/C=C/[O-])/C=C/O |
| InChI | InChI=1S/C5H6O3/c6-3-1-5(8)2-4-7/h1-4,6-7H/p-1/b3-1+,4-2+ |
| InChIKey | XIYFTKXPNAEZJA-ZPUQHVIOSA-M |
| XLogP | -0.50 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.09 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (1E,4E)-5-hydroxy-3-oxopenta-1,4-dien-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,4E)-5-hydroxy-3-oxopenta-1,4-dien-1-olate?
The IUPAC name of (1E,4E)-5-hydroxy-3-oxopenta-1,4-dien-1-olate (CID 101141300) is (1E,4E)-5-hydroxy-3-oxopenta-1,4-dien-1-olate.
What is the SMILES notation for (1E,4E)-5-hydroxy-3-oxopenta-1,4-dien-1-olate?
The canonical SMILES for (1E,4E)-5-hydroxy-3-oxopenta-1,4-dien-1-olate is O=C(/C=C/[O-])/C=C/O.
What is the InChIKey of (1E,4E)-5-hydroxy-3-oxopenta-1,4-dien-1-olate?
The InChIKey is XIYFTKXPNAEZJA-ZPUQHVIOSA-M. The full InChI is InChI=1S/C5H6O3/c6-3-1-5(8)2-4-7/h1-4,6-7H/p-1/b3-1+,4-2+.
What are the key properties of (1E,4E)-5-hydroxy-3-oxopenta-1,4-dien-1-olate?
(1E,4E)-5-hydroxy-3-oxopenta-1,4-dien-1-olate has a molecular weight of 113.09 g/mol, XLogP of -0.50, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,4E)-5-hydroxy-3-oxopenta-1,4-dien-1-olate is sourced from PubChem (CID 101141300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).