C32H36N2O5 — CID 101141422
4-[1,3-dioxo-4,7-bis(phenylmethoxy)isoindol-2-yl]-N,N-di(propan-2-yl)butanamide (PubChem CID 101141422) has the molecular formula C32H36N2O5 and a molecular weight of 528.65 g/mol. Its IUPAC name is 4-[1,3-dioxo-4,7-bis(phenylmethoxy)isoindol-2-yl]-N,N-di(propan-2-yl)butanamide.
| Compound Name | 4-[1,3-dioxo-4,7-bis(phenylmethoxy)isoindol-2-yl]-N,N-di(propan-2-yl)butanamide |
|---|---|
| PubChem CID | 101141422 |
| Molecular Formula | C32H36N2O5 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | 4-[1,3-dioxo-4,7-bis(phenylmethoxy)isoindol-2-yl]-N,N-di(propan-2-yl)butanamide |
| SMILES | CC(C)N(C(=O)CCCN1C(=O)c2c(OCc3ccccc3)ccc(OCc3ccccc3)c2C1=O)C(C)C |
| InChI | InChI=1S/C32H36N2O5/c1-22(2)34(23(3)4)28(35)16-11-19-33-31(36)29-26(38-20-24-12-7-5-8-13-24)17-18-27(30(29)32(33)37)39-21-25-14-9-6-10-15-25/h5-10,12-15,17-18,22-23H,11,16,19-21H2,1-4H3 |
| InChIKey | PXMOBROHNZPLTM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|