About 2,3-dimethoxy-5,6-dioxocyclohexa-1,3-diene-1-carbaldehyde
2,3-dimethoxy-5,6-dioxocyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 101141525) has the molecular formula C9H8O5
and a molecular weight of 196.16 g/mol. Its IUPAC name is 2,3-dimethoxy-5,6-dioxocyclohexa-1,3-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 2,3-dimethoxy-5,6-dioxocyclohexa-1,3-diene-1-carbaldehyde |
| PubChem CID | 101141525 |
| Molecular Formula | C9H8O5 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 2,3-dimethoxy-5,6-dioxocyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | COC1=CC(=O)C(=O)C(C=O)=C1OC |
| InChI | InChI=1S/C9H8O5/c1-13-7-3-6(11)8(12)5(4-10)9(7)14-2/h3-4H,1-2H3 |
| InChIKey | JNSVXUZCUJSKAO-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethoxy-5,6-dioxocyclohexa-1,3-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethoxy-5,6-dioxocyclohexa-1,3-diene-1-carbaldehyde?
The IUPAC name of 2,3-dimethoxy-5,6-dioxocyclohexa-1,3-diene-1-carbaldehyde (CID 101141525) is 2,3-dimethoxy-5,6-dioxocyclohexa-1,3-diene-1-carbaldehyde.
What is the SMILES notation for 2,3-dimethoxy-5,6-dioxocyclohexa-1,3-diene-1-carbaldehyde?
The canonical SMILES for 2,3-dimethoxy-5,6-dioxocyclohexa-1,3-diene-1-carbaldehyde is COC1=CC(=O)C(=O)C(C=O)=C1OC.
What is the InChIKey of 2,3-dimethoxy-5,6-dioxocyclohexa-1,3-diene-1-carbaldehyde?
The InChIKey is JNSVXUZCUJSKAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O5/c1-13-7-3-6(11)8(12)5(4-10)9(7)14-2/h3-4H,1-2H3.
What are the key properties of 2,3-dimethoxy-5,6-dioxocyclohexa-1,3-diene-1-carbaldehyde?
2,3-dimethoxy-5,6-dioxocyclohexa-1,3-diene-1-carbaldehyde has a molecular weight of 196.16 g/mol, XLogP of -0.23, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethoxy-5,6-dioxocyclohexa-1,3-diene-1-carbaldehyde is sourced from PubChem (CID 101141525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).