C31H32O4 — CID 101141661
(3R,4R)-3-benzoyl-4-butyl-8,8-diphenyl-6,10-dioxaspiro[4.5]decan-2-one (PubChem CID 101141661) has the molecular formula C31H32O4 and a molecular weight of 468.59 g/mol. Its IUPAC name is (3R,4R)-3-benzoyl-4-butyl-8,8-diphenyl-6,10-dioxaspiro[4.5]decan-2-one.
| Compound Name | (3R,4R)-3-benzoyl-4-butyl-8,8-diphenyl-6,10-dioxaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 101141661 |
| Molecular Formula | C31H32O4 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | (3R,4R)-3-benzoyl-4-butyl-8,8-diphenyl-6,10-dioxaspiro[4.5]decan-2-one |
| SMILES | CCCC[C@@H]1[C@@H](C(=O)c2ccccc2)C(=O)CC12OCC(c1ccccc1)(c1ccccc1)CO2 |
| InChI | InChI=1S/C31H32O4/c1-2-3-19-26-28(29(33)23-13-7-4-8-14-23)27(32)20-31(26)34-21-30(22-35-31,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-18,26,28H,2-3,19-22H2,1H3/t26-,28-/m1/s1 |
| InChIKey | BQOJOXXDMGDVBS-IXCJQBJRSA-N |
| XLogP | 5.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|