C19H31BrO4Si — CID 101141681
4-bromo-2-[1-[tert-butyl(dimethyl)silyl]oxypent-4-enyl]-6,6-dimethoxycyclohexa-2,4-dien-1-one (PubChem CID 101141681) has the molecular formula C19H31BrO4Si and a molecular weight of 431.44 g/mol. Its IUPAC name is 4-bromo-2-[1-[tert-butyl(dimethyl)silyl]oxypent-4-enyl]-6,6-dimethoxycyclohexa-2,4-dien-1-one.
| Compound Name | 4-bromo-2-[1-[tert-butyl(dimethyl)silyl]oxypent-4-enyl]-6,6-dimethoxycyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 101141681 |
| Molecular Formula | C19H31BrO4Si |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 4-bromo-2-[1-[tert-butyl(dimethyl)silyl]oxypent-4-enyl]-6,6-dimethoxycyclohexa-2,4-dien-1-one |
| SMILES | C=CCCC(O[Si](C)(C)C(C)(C)C)C1=CC(Br)=CC(OC)(OC)C1=O |
| InChI | InChI=1S/C19H31BrO4Si/c1-9-10-11-16(24-25(7,8)18(2,3)4)15-12-14(20)13-19(22-5,23-6)17(15)21/h9,12-13,16H,1,10-11H2,2-8H3 |
| InChIKey | WTLJOZSLXQDKCP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|