C20H30Cl4Si2 — CID 101141723
dichloro-[dichloro-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)silyl]-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 101141723) has the molecular formula C20H30Cl4Si2 and a molecular weight of 468.44 g/mol. Its IUPAC name is dichloro-[dichloro-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)silyl]-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | dichloro-[dichloro-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)silyl]-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 101141723 |
| Molecular Formula | C20H30Cl4Si2 |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | dichloro-[dichloro-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)silyl]-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=C(C)C(C)([Si](Cl)(Cl)[Si](Cl)(Cl)C2(C)C(C)=C(C)C(C)=C2C)C(C)=C1C |
| InChI | InChI=1S/C20H30Cl4Si2/c1-11-12(2)16(6)19(9,15(11)5)25(21,22)26(23,24)20(10)17(7)13(3)14(4)18(20)8/h1-10H3 |
| InChIKey | GOEITYDJHTZWDA-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|