About (E)-1,10-bis[4-(2-hydroxyethyl)phenyl]dec-5-ene-1,10-diol
(E)-1,10-bis[4-(2-hydroxyethyl)phenyl]dec-5-ene-1,10-diol (PubChem CID 101142294) has the molecular formula C26H36O4
and a molecular weight of 412.57 g/mol. Its IUPAC name is (E)-1,10-bis[4-(2-hydroxyethyl)phenyl]dec-5-ene-1,10-diol.
Molecular Properties
| Compound Name | (E)-1,10-bis[4-(2-hydroxyethyl)phenyl]dec-5-ene-1,10-diol |
| PubChem CID | 101142294 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | (E)-1,10-bis[4-(2-hydroxyethyl)phenyl]dec-5-ene-1,10-diol |
| SMILES | OCCc1ccc(C(O)CCC/C=C/CCCC(O)c2ccc(CCO)cc2)cc1 |
| InChI | InChI=1S/C26H36O4/c27-19-17-21-9-13-23(14-10-21)25(29)7-5-3-1-2-4-6-8-26(30)24-15-11-22(12-16-24)18-20-28/h1-2,9-16,25-30H,3-8,17-20H2/b2-1+ |
| InChIKey | YZYGSDIADJCZAN-OWOJBTEDSA-N |
| XLogP | 4.42 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,10-bis[4-(2-hydroxyethyl)phenyl]dec-5-ene-1,10-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,10-bis[4-(2-hydroxyethyl)phenyl]dec-5-ene-1,10-diol?
The IUPAC name of (E)-1,10-bis[4-(2-hydroxyethyl)phenyl]dec-5-ene-1,10-diol (CID 101142294) is (E)-1,10-bis[4-(2-hydroxyethyl)phenyl]dec-5-ene-1,10-diol.
What is the SMILES notation for (E)-1,10-bis[4-(2-hydroxyethyl)phenyl]dec-5-ene-1,10-diol?
The canonical SMILES for (E)-1,10-bis[4-(2-hydroxyethyl)phenyl]dec-5-ene-1,10-diol is OCCc1ccc(C(O)CCC/C=C/CCCC(O)c2ccc(CCO)cc2)cc1.
What is the InChIKey of (E)-1,10-bis[4-(2-hydroxyethyl)phenyl]dec-5-ene-1,10-diol?
The InChIKey is YZYGSDIADJCZAN-OWOJBTEDSA-N. The full InChI is InChI=1S/C26H36O4/c27-19-17-21-9-13-23(14-10-21)25(29)7-5-3-1-2-4-6-8-26(30)24-15-11-22(12-16-24)18-20-28/h1-2,9-16,25-30H,3-8,17-20H2/b2-1+.
What are the key properties of (E)-1,10-bis[4-(2-hydroxyethyl)phenyl]dec-5-ene-1,10-diol?
(E)-1,10-bis[4-(2-hydroxyethyl)phenyl]dec-5-ene-1,10-diol has a molecular weight of 412.57 g/mol, XLogP of 4.42, 14 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,10-bis[4-(2-hydroxyethyl)phenyl]dec-5-ene-1,10-diol is sourced from PubChem (CID 101142294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).