C16H30O3Si2 — CID 101142460
(E,3S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,5-bis(trimethylsilyl)pent-1-en-4-yn-3-ol (PubChem CID 101142460) has the molecular formula C16H30O3Si2 and a molecular weight of 326.59 g/mol. Its IUPAC name is (E,3S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,5-bis(trimethylsilyl)pent-1-en-4-yn-3-ol.
| Compound Name | (E,3S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,5-bis(trimethylsilyl)pent-1-en-4-yn-3-ol |
|---|---|
| PubChem CID | 101142460 |
| Molecular Formula | C16H30O3Si2 |
| Molecular Weight | 326.59 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | (E,3S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,5-bis(trimethylsilyl)pent-1-en-4-yn-3-ol |
| SMILES | CC1(C)OC[C@@H]([C@@](O)(C#C[Si](C)(C)C)/C=C/[Si](C)(C)C)O1 |
| InChI | InChI=1S/C16H30O3Si2/c1-15(2)18-13-14(19-15)16(17,9-11-20(3,4)5)10-12-21(6,7)8/h9,11,14,17H,13H2,1-8H3/b11-9+/t14-,16-/m0/s1 |
| InChIKey | AZWRSFMWSKPHKF-NBRGXKJWSA-N |
| XLogP | 3.18 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.59 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|