About 2-[2-(3,4-dimethoxyphenyl)propoxy]-1,3-dimethylbenzene
2-[2-(3,4-dimethoxyphenyl)propoxy]-1,3-dimethylbenzene (PubChem CID 101142620) has the molecular formula C19H24O3
and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)propoxy]-1,3-dimethylbenzene.
Molecular Properties
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)propoxy]-1,3-dimethylbenzene |
| PubChem CID | 101142620 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)propoxy]-1,3-dimethylbenzene |
| SMILES | COc1ccc(C(C)COc2c(C)cccc2C)cc1OC |
| InChI | InChI=1S/C19H24O3/c1-13-7-6-8-14(2)19(13)22-12-15(3)16-9-10-17(20-4)18(11-16)21-5/h6-11,15H,12H2,1-5H3 |
| InChIKey | AXWDXHNODMHNIR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(3,4-dimethoxyphenyl)propoxy]-1,3-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,4-dimethoxyphenyl)propoxy]-1,3-dimethylbenzene?
The IUPAC name of 2-[2-(3,4-dimethoxyphenyl)propoxy]-1,3-dimethylbenzene (CID 101142620) is 2-[2-(3,4-dimethoxyphenyl)propoxy]-1,3-dimethylbenzene.
What is the SMILES notation for 2-[2-(3,4-dimethoxyphenyl)propoxy]-1,3-dimethylbenzene?
The canonical SMILES for 2-[2-(3,4-dimethoxyphenyl)propoxy]-1,3-dimethylbenzene is COc1ccc(C(C)COc2c(C)cccc2C)cc1OC.
What is the InChIKey of 2-[2-(3,4-dimethoxyphenyl)propoxy]-1,3-dimethylbenzene?
The InChIKey is AXWDXHNODMHNIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O3/c1-13-7-6-8-14(2)19(13)22-12-15(3)16-9-10-17(20-4)18(11-16)21-5/h6-11,15H,12H2,1-5H3.
What are the key properties of 2-[2-(3,4-dimethoxyphenyl)propoxy]-1,3-dimethylbenzene?
2-[2-(3,4-dimethoxyphenyl)propoxy]-1,3-dimethylbenzene has a molecular weight of 300.40 g/mol, XLogP of 4.50, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,4-dimethoxyphenyl)propoxy]-1,3-dimethylbenzene is sourced from PubChem (CID 101142620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).