C12H28O3Si — CID 101142628
(2S,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylpentane-1,3-diol (PubChem CID 101142628) has the molecular formula C12H28O3Si and a molecular weight of 248.44 g/mol. Its IUPAC name is (2S,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylpentane-1,3-diol.
| Compound Name | (2S,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylpentane-1,3-diol |
|---|---|
| PubChem CID | 101142628 |
| Molecular Formula | C12H28O3Si |
| Molecular Weight | 248.44 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (2S,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylpentane-1,3-diol |
| SMILES | C[C@@H](CO)[C@H](O)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H28O3Si/c1-9(8-13)11(14)10(2)15-16(6,7)12(3,4)5/h9-11,13-14H,8H2,1-7H3/t9-,10+,11-/m0/s1 |
| InChIKey | VGUGTMCXGPXZOU-AXFHLTTASA-N |
| XLogP | 2.39 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|