About 1-[(E)-1-fluoro-4,4-dimethylpent-1-enyl]sulfonyl-4-methylbenzene
1-[(E)-1-fluoro-4,4-dimethylpent-1-enyl]sulfonyl-4-methylbenzene (PubChem CID 101142846) has the molecular formula C14H19FO2S
and a molecular weight of 270.37 g/mol. Its IUPAC name is 1-[(E)-1-fluoro-4,4-dimethylpent-1-enyl]sulfonyl-4-methylbenzene.
Molecular Properties
| Compound Name | 1-[(E)-1-fluoro-4,4-dimethylpent-1-enyl]sulfonyl-4-methylbenzene |
| PubChem CID | 101142846 |
| Molecular Formula | C14H19FO2S |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 1-[(E)-1-fluoro-4,4-dimethylpent-1-enyl]sulfonyl-4-methylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)/C(F)=C/CC(C)(C)C)cc1 |
| InChI | InChI=1S/C14H19FO2S/c1-11-5-7-12(8-6-11)18(16,17)13(15)9-10-14(2,3)4/h5-9H,10H2,1-4H3/b13-9+ |
| InChIKey | XASXLGWLUBOXAI-UKTHLTGXSA-N |
| XLogP | 4.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(E)-1-fluoro-4,4-dimethylpent-1-enyl]sulfonyl-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-1-fluoro-4,4-dimethylpent-1-enyl]sulfonyl-4-methylbenzene?
The IUPAC name of 1-[(E)-1-fluoro-4,4-dimethylpent-1-enyl]sulfonyl-4-methylbenzene (CID 101142846) is 1-[(E)-1-fluoro-4,4-dimethylpent-1-enyl]sulfonyl-4-methylbenzene.
What is the SMILES notation for 1-[(E)-1-fluoro-4,4-dimethylpent-1-enyl]sulfonyl-4-methylbenzene?
The canonical SMILES for 1-[(E)-1-fluoro-4,4-dimethylpent-1-enyl]sulfonyl-4-methylbenzene is Cc1ccc(S(=O)(=O)/C(F)=C/CC(C)(C)C)cc1.
What is the InChIKey of 1-[(E)-1-fluoro-4,4-dimethylpent-1-enyl]sulfonyl-4-methylbenzene?
The InChIKey is XASXLGWLUBOXAI-UKTHLTGXSA-N. The full InChI is InChI=1S/C14H19FO2S/c1-11-5-7-12(8-6-11)18(16,17)13(15)9-10-14(2,3)4/h5-9H,10H2,1-4H3/b13-9+.
What are the key properties of 1-[(E)-1-fluoro-4,4-dimethylpent-1-enyl]sulfonyl-4-methylbenzene?
1-[(E)-1-fluoro-4,4-dimethylpent-1-enyl]sulfonyl-4-methylbenzene has a molecular weight of 270.37 g/mol, XLogP of 4.02, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-1-fluoro-4,4-dimethylpent-1-enyl]sulfonyl-4-methylbenzene is sourced from PubChem (CID 101142846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).