C30H36N2O4 — CID 101142992
3-[[(1S,2S)-2-[(2-acetyl-3-oxobutylidene)amino]-1,2-bis(3,5-dimethylphenyl)ethyl]iminomethyl]pentane-2,4-dione (PubChem CID 101142992) has the molecular formula C30H36N2O4 and a molecular weight of 488.63 g/mol. Its IUPAC name is 3-[[(1S,2S)-2-[(2-acetyl-3-oxobutylidene)amino]-1,2-bis(3,5-dimethylphenyl)ethyl]iminomethyl]pentane-2,4-dione.
| Compound Name | 3-[[(1S,2S)-2-[(2-acetyl-3-oxobutylidene)amino]-1,2-bis(3,5-dimethylphenyl)ethyl]iminomethyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 101142992 |
| Molecular Formula | C30H36N2O4 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | 3-[[(1S,2S)-2-[(2-acetyl-3-oxobutylidene)amino]-1,2-bis(3,5-dimethylphenyl)ethyl]iminomethyl]pentane-2,4-dione |
| SMILES | CC(=O)C(/C=N/[C@@H](c1cc(C)cc(C)c1)[C@@H](/N=C/C(C(C)=O)C(C)=O)c1cc(C)cc(C)c1)C(C)=O |
| InChI | InChI=1S/C30H36N2O4/c1-17-9-18(2)12-25(11-17)29(31-15-27(21(5)33)22(6)34)30(26-13-19(3)10-20(4)14-26)32-16-28(23(7)35)24(8)36/h9-16,27-30H,1-8H3/b31-15+,32-16+/t29-,30-/m0/s1 |
| InChIKey | ITFXNBLEOSUKPP-CSTGVAOWSA-N |
| XLogP | 5.43 |
| TPSA | 93.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|