C32H40N2O6 — CID 101142994
tert-butyl 2-[[(1S,2S)-2-[[2-[(2-methylpropan-2-yl)oxycarbonyl]-3-oxobutylidene]amino]-1,2-diphenylethyl]iminomethyl]-3-oxobutanoate (PubChem CID 101142994) has the molecular formula C32H40N2O6 and a molecular weight of 548.68 g/mol. Its IUPAC name is tert-butyl 2-[[(1S,2S)-2-[[2-[(2-methylpropan-2-yl)oxycarbonyl]-3-oxobutylidene]amino]-1,2-diphenylethyl]iminomethyl]-3-oxobutanoate.
| Compound Name | tert-butyl 2-[[(1S,2S)-2-[[2-[(2-methylpropan-2-yl)oxycarbonyl]-3-oxobutylidene]amino]-1,2-diphenylethyl]iminomethyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 101142994 |
| Molecular Formula | C32H40N2O6 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | tert-butyl 2-[[(1S,2S)-2-[[2-[(2-methylpropan-2-yl)oxycarbonyl]-3-oxobutylidene]amino]-1,2-diphenylethyl]iminomethyl]-3-oxobutanoate |
| SMILES | CC(=O)C(/C=N/[C@@H](c1ccccc1)[C@@H](/N=C/C(C(C)=O)C(=O)OC(C)(C)C)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H40N2O6/c1-21(35)25(29(37)39-31(3,4)5)19-33-27(23-15-11-9-12-16-23)28(24-17-13-10-14-18-24)34-20-26(22(2)36)30(38)40-32(6,7)8/h9-20,25-28H,1-8H3/b33-19+,34-20+/t25?,26?,27-,28-/m0/s1 |
| InChIKey | MRCAZUDOTWKGMH-UOQYFZROSA-N |
| XLogP | 5.70 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|