C19H32O5Si — CID 101143419
[(2R,3R,6R)-3-acetyloxy-6-(2-triethylsilylprop-2-enyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 101143419) has the molecular formula C19H32O5Si and a molecular weight of 368.55 g/mol. Its IUPAC name is [(2R,3R,6R)-3-acetyloxy-6-(2-triethylsilylprop-2-enyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3R,6R)-3-acetyloxy-6-(2-triethylsilylprop-2-enyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101143419 |
| Molecular Formula | C19H32O5Si |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | [(2R,3R,6R)-3-acetyloxy-6-(2-triethylsilylprop-2-enyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | C=C(C[C@@H]1C=C[C@@H](OC(C)=O)[C@@H](COC(C)=O)O1)[Si](CC)(CC)CC |
| InChI | InChI=1S/C19H32O5Si/c1-7-25(8-2,9-3)14(4)12-17-10-11-18(23-16(6)21)19(24-17)13-22-15(5)20/h10-11,17-19H,4,7-9,12-13H2,1-3,5-6H3/t17-,18+,19+/m0/s1 |
| InChIKey | LPJRHQJAZFQOIK-IPMKNSEASA-N |
| XLogP | 3.80 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|