C31H42O8Si — CID 101143712
ethyl (Z,4R)-2-acetyloxy-4-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-1,3-dioxan-4-yl]-4-phenylmethoxybut-2-enoate (PubChem CID 101143712) has the molecular formula C31H42O8Si and a molecular weight of 570.76 g/mol. Its IUPAC name is ethyl (Z,4R)-2-acetyloxy-4-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-1,3-dioxan-4-yl]-4-phenylmethoxybut-2-enoate.
| Compound Name | ethyl (Z,4R)-2-acetyloxy-4-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-1,3-dioxan-4-yl]-4-phenylmethoxybut-2-enoate |
|---|---|
| PubChem CID | 101143712 |
| Molecular Formula | C31H42O8Si |
| Molecular Weight | 570.76 g/mol |
| Exact Mass | 570.26 |
| IUPAC Name | ethyl (Z,4R)-2-acetyloxy-4-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-1,3-dioxan-4-yl]-4-phenylmethoxybut-2-enoate |
| SMILES | CCOC(=O)/C(=C/[C@@H](OCc1ccccc1)[C@@H]1O[C@H](c2ccccc2)OC[C@H]1O[Si](C)(C)C(C)(C)C)OC(C)=O |
| InChI | InChI=1S/C31H42O8Si/c1-8-34-29(33)26(37-22(2)32)19-25(35-20-23-15-11-9-12-16-23)28-27(39-40(6,7)31(3,4)5)21-36-30(38-28)24-17-13-10-14-18-24/h9-19,25,27-28,30H,8,20-21H2,1-7H3/b26-19-/t25-,27-,28+,30-/m1/s1 |
| InChIKey | LBTZHHOGYBEJNE-QPMTUZEQSA-N |
| XLogP | 6.09 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.76 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|