C13H22O3 — CID 101143841
ethyl 2-[(2S,5R)-5-propan-2-yloxan-2-yl]prop-2-enoate (PubChem CID 101143841) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is ethyl 2-[(2S,5R)-5-propan-2-yloxan-2-yl]prop-2-enoate.
| Compound Name | ethyl 2-[(2S,5R)-5-propan-2-yloxan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 101143841 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | ethyl 2-[(2S,5R)-5-propan-2-yloxan-2-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OCC)[C@@H]1CC[C@H](C(C)C)CO1 |
| InChI | InChI=1S/C13H22O3/c1-5-15-13(14)10(4)12-7-6-11(8-16-12)9(2)3/h9,11-12H,4-8H2,1-3H3/t11-,12-/m0/s1 |
| InChIKey | QOTFTUPIPASHOK-RYUDHWBXSA-N |
| XLogP | 2.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|