C35H76O4Si3 — CID 101144070
(6S,7S,8R,11S)-7,11,13-tris[[tert-butyl(dimethyl)silyl]oxy]-6,8,10,10-tetramethyltridecan-2-one (PubChem CID 101144070) has the molecular formula C35H76O4Si3 and a molecular weight of 645.25 g/mol. Its IUPAC name is (6S,7S,8R,11S)-7,11,13-tris[[tert-butyl(dimethyl)silyl]oxy]-6,8,10,10-tetramethyltridecan-2-one.
| Compound Name | (6S,7S,8R,11S)-7,11,13-tris[[tert-butyl(dimethyl)silyl]oxy]-6,8,10,10-tetramethyltridecan-2-one |
|---|---|
| PubChem CID | 101144070 |
| Molecular Formula | C35H76O4Si3 |
| Molecular Weight | 645.25 g/mol |
| Exact Mass | 644.51 |
| IUPAC Name | (6S,7S,8R,11S)-7,11,13-tris[[tert-butyl(dimethyl)silyl]oxy]-6,8,10,10-tetramethyltridecan-2-one |
| SMILES | CC(=O)CCC[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CC(C)(C)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H76O4Si3/c1-27(22-21-23-29(3)36)31(39-42(19,20)34(10,11)12)28(2)26-35(13,14)30(38-41(17,18)33(7,8)9)24-25-37-40(15,16)32(4,5)6/h27-28,30-31H,21-26H2,1-20H3/t27-,28+,30-,31-/m0/s1 |
| InChIKey | ARGDOCLCURPNFA-WRLHONTGSA-N |
| XLogP | 11.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.25 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|