C24H34O17 — CID 101144340
[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-3-hydroxy-6-[(2R,3R,4S,5R,6S)-4,5,6-triacetyloxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 101144340) has the molecular formula C24H34O17 and a molecular weight of 594.52 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-3-hydroxy-6-[(2R,3R,4S,5R,6S)-4,5,6-triacetyloxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-3-hydroxy-6-[(2R,3R,4S,5R,6S)-4,5,6-triacetyloxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101144340 |
| Molecular Formula | C24H34O17 |
| Molecular Weight | 594.52 g/mol |
| Exact Mass | 594.18 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-3-hydroxy-6-[(2R,3R,4S,5R,6S)-4,5,6-triacetyloxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[C@H]2[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)O[C@@H]2CO)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1O |
| InChI | InChI=1S/C24H34O17/c1-9(26)33-8-16-17(32)19(34-10(2)27)21(36-12(4)29)24(40-16)41-18-15(7-25)39-23(38-14(6)31)22(37-13(5)30)20(18)35-11(3)28/h15-25,32H,7-8H2,1-6H3/t15-,16-,17-,18-,19+,20+,21-,22-,23-,24+/m1/s1 |
| InChIKey | FQOIMXQXKNPUPE-KVKIQERZSA-N |
| XLogP | -1.97 |
| TPSA | 225.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.52 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|