About triphenylene-1,5,9-triamine
triphenylene-1,5,9-triamine (PubChem CID 101144628) has the molecular formula C18H15N3
and a molecular weight of 273.34 g/mol. Its IUPAC name is triphenylene-1,5,9-triamine.
Molecular Properties
| Compound Name | triphenylene-1,5,9-triamine |
| PubChem CID | 101144628 |
| Molecular Formula | C18H15N3 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | triphenylene-1,5,9-triamine |
| SMILES | Nc1cccc2c1c1cccc(N)c1c1cccc(N)c21 |
| InChI | InChI=1S/C18H15N3/c19-13-7-1-4-10-16(13)11-5-2-9-15(21)18(11)12-6-3-8-14(20)17(10)12/h1-9H,19-21H2 |
| InChIKey | TXQXBGIHSVUGNV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze triphenylene-1,5,9-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenylene-1,5,9-triamine?
The IUPAC name of triphenylene-1,5,9-triamine (CID 101144628) is triphenylene-1,5,9-triamine.
What is the SMILES notation for triphenylene-1,5,9-triamine?
The canonical SMILES for triphenylene-1,5,9-triamine is Nc1cccc2c1c1cccc(N)c1c1cccc(N)c21.
What is the InChIKey of triphenylene-1,5,9-triamine?
The InChIKey is TXQXBGIHSVUGNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3/c19-13-7-1-4-10-16(13)11-5-2-9-15(21)18(11)12-6-3-8-14(20)17(10)12/h1-9H,19-21H2.
What are the key properties of triphenylene-1,5,9-triamine?
triphenylene-1,5,9-triamine has a molecular weight of 273.34 g/mol, XLogP of 3.89, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triphenylene-1,5,9-triamine is sourced from PubChem (CID 101144628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).