C19H28O7 — CID 101144803
ethyl (E)-3-[(4R,5R)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-prop-2-ynoxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate (PubChem CID 101144803) has the molecular formula C19H28O7 and a molecular weight of 368.43 g/mol. Its IUPAC name is ethyl (E)-3-[(4R,5R)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-prop-2-ynoxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(4R,5R)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-prop-2-ynoxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 101144803 |
| Molecular Formula | C19H28O7 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | ethyl (E)-3-[(4R,5R)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-prop-2-ynoxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
| SMILES | C#CCO[C@@H]([C@@H]1OC(C)(C)O[C@@H]1/C=C/C(=O)OCC)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C19H28O7/c1-7-11-22-16(14-12-23-18(3,4)25-14)17-13(24-19(5,6)26-17)9-10-15(20)21-8-2/h1,9-10,13-14,16-17H,8,11-12H2,2-6H3/b10-9+/t13-,14-,16-,17-/m1/s1 |
| InChIKey | RFHUZXVZCHQBSC-VAFWRARPSA-N |
| XLogP | 1.80 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|