About 5,8-ditert-butyl-2,3-dihydrophenalen-1-one
5,8-ditert-butyl-2,3-dihydrophenalen-1-one (PubChem CID 101144956) has the molecular formula C21H26O
and a molecular weight of 294.44 g/mol. Its IUPAC name is 5,8-ditert-butyl-2,3-dihydrophenalen-1-one.
Molecular Properties
| Compound Name | 5,8-ditert-butyl-2,3-dihydrophenalen-1-one |
| PubChem CID | 101144956 |
| Molecular Formula | C21H26O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 5,8-ditert-butyl-2,3-dihydrophenalen-1-one |
| SMILES | CC(C)(C)c1cc2c3c(cc(C(C)(C)C)cc3c1)C(=O)CC2 |
| InChI | InChI=1S/C21H26O/c1-20(2,3)15-9-13-7-8-18(22)17-12-16(21(4,5)6)11-14(10-15)19(13)17/h9-12H,7-8H2,1-6H3 |
| InChIKey | CDSFGHUXNRVRKP-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,8-ditert-butyl-2,3-dihydrophenalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-ditert-butyl-2,3-dihydrophenalen-1-one?
The IUPAC name of 5,8-ditert-butyl-2,3-dihydrophenalen-1-one (CID 101144956) is 5,8-ditert-butyl-2,3-dihydrophenalen-1-one.
What is the SMILES notation for 5,8-ditert-butyl-2,3-dihydrophenalen-1-one?
The canonical SMILES for 5,8-ditert-butyl-2,3-dihydrophenalen-1-one is CC(C)(C)c1cc2c3c(cc(C(C)(C)C)cc3c1)C(=O)CC2.
What is the InChIKey of 5,8-ditert-butyl-2,3-dihydrophenalen-1-one?
The InChIKey is CDSFGHUXNRVRKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26O/c1-20(2,3)15-9-13-7-8-18(22)17-12-16(21(4,5)6)11-14(10-15)19(13)17/h9-12H,7-8H2,1-6H3.
What are the key properties of 5,8-ditert-butyl-2,3-dihydrophenalen-1-one?
5,8-ditert-butyl-2,3-dihydrophenalen-1-one has a molecular weight of 294.44 g/mol, XLogP of 5.56, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-ditert-butyl-2,3-dihydrophenalen-1-one is sourced from PubChem (CID 101144956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).